Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17024 | Purity: >98% |
 | |
| Chemical structure of LSN3172176 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms 2 | LSN-3172176 |
|---|---|
| CAS No. | 3033820-85-5 |
| Purity | >98% |
| Formula | C22H31N3O3 |
| Mol Weight | 385.4998 |
| CoA | CoA of LSN3172176 |
| Smiles: | O=C(N1CCC(N2CCC(N3C(CC4=C3C=C(C)C=C4)=O)CC2)CC1)OCC |
|---|
KEYWORDS: buy LSN3172176 | LSN3172176 supplier | purchase | cost | manufacturer | order | distributor | buy 3033820-85-5 | 3033820-85-5 supplier