Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8188 | Purity: >98% |
 | |
| Chemical structure of LPDA-3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2176490-05-2 |
|---|---|
| Purity | >98% |
| Formula | C29H34N2O |
| Mol Weight | 426.5931 |
| CoA | CoA of LPDA-3 |
| Smiles: | O=C(C(C1=CC=CC=C1)(CCN2CCC(CC2)C3=CC=CC=C3)C4=CC=CC=C4)N(C)C |
|---|
KEYWORDS: buy LPDA-3 | LPDA-3 supplier | purchase | cost | manufacturer | order | distributor | buy 2176490-05-2 | 2176490-05-2 supplier