Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1697 | Purity: 0.999 |
 | |
| Chemical structure of Lorcaserin hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 846589-98-8 |
|---|---|
| Purity | 0.999 |
| Formula | C11H15Cl2N |
| Mol Weight | 232.15 |
| CoA | CoA of Lorcaserin hydrochloride |
| Smiles: | Cl[H].C[C@H]1CNCCC2=CC=C(Cl)C=C12 |
|---|
KEYWORDS: buy Lorcaserin hydrochloride | Lorcaserin hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 846589-98-8 | 846589-98-8 supplier