Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16200 | Purity: >98% |
 | |
| Chemical structure of LL-00066471 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1639959-04-8 |
|---|---|
| Purity | >98% |
| Formula | C23H23ClN2O3S |
| Mol Weight | 442.958 |
| CoA | CoA of LL-00066471 |
| Smiles: | O=C(C1=C(C=2C=CC(=CC2)S(=O)(=O)N)C(=C(C=3C=CC(Cl)=CC3)N1C)C)CC4CC4 |
|---|
KEYWORDS: buy LL-00066471 | LL-00066471 supplier | purchase | cost | manufacturer | order | distributor | buy 1639959-04-8 | 1639959-04-8 supplier