Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1129 | Purity: >98% |
 | |
| Chemical structure of Lixivaptan |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 168079-32-1 |
|---|---|
| Purity | >98% |
| Formula | C27H21ClFN3O2 |
| Mol Weight | 473.926 |
| CoA | CoA of Lixivaptan |
| Smiles: | CC1=CC=C(F)C=C1C(=O)NC1=CC=C(C(=O)N2CC3=CC=CN3CC3=CC=CC=C23)C(Cl)=C1 |
|---|
KEYWORDS: buy Lixivaptan | Lixivaptan supplier | purchase | cost | manufacturer | order | distributor | buy 168079-32-1 | 168079-32-1 supplier