Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2398 | Purity: >98% |
 | |
| Chemical structure of Leukadherin-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 344897-95-6 |
|---|---|
| Purity | >98% |
| Formula | C22H15NO4S2 |
| Mol Weight | 421.489 |
| CoA | CoA of Leukadherin-1 |
| Smiles: | OC(=O)C1=CC=C(C=C1)C1=CC=C(O1)\C=C1/SC(=S)N(CC2=CC=CC=C2)C1=O |
|---|
KEYWORDS: buy Leukadherin-1 | Leukadherin-1 supplier | purchase | cost | manufacturer | order | distributor | buy 344897-95-6 | 344897-95-6 supplier