Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8571 | Purity: >98% |
 | |
| Chemical structure of LEI-515 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2702249-95-2 |
|---|---|
| Purity | >98% |
| Formula | C24H26Cl2F2N2O3S |
| Mol Weight | 531.443 |
| CoA | CoA of LEI-515 |
| Smiles: | CCC(F)(C(CS(C1=C(C=C(C=C1)C(N2CCN([C@H]([C@@H]2C)C)C3=CC=CC(Cl)=C3)=O)Cl)=O)=O)F |
|---|
KEYWORDS: buy LEI-515 | LEI-515 supplier | purchase | cost | manufacturer | order | distributor | buy 2702249-95-2 | 2702249-95-2 supplier