Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9048 | Purity: >98% |
 | |
| Chemical structure of LDN-76070 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 838842-80-1 |
|---|---|
| Purity | >98% |
| Formula | C18H17BrFNO4 |
| Mol Weight | 410.234 |
| CoA | CoA of LDN-76070 |
| Smiles: | O=C1NC2=CC(OC)=C(OC)C(OC)=C2C(C3=CC(Br)=CC=C3F)C1 |
|---|
KEYWORDS: buy LDN-76070 | LDN-76070 supplier | purchase | cost | manufacturer | order | distributor | buy 838842-80-1 | 838842-80-1 supplier