Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2265 | Purity: >98% |
 | |
| Chemical structure of LDC1267 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1361030-48-9 |
|---|---|
| Purity | >98% |
| Formula | C30H26F2N4O5 |
| Mol Weight | 560.548 |
| CoA | CoA of LDC1267 |
| Smiles: | CCOC1=CN(N=C1C(=O)NC1=CC(F)=C(OC2=C3C=C(OC)C(OC)=CC3=NC=C2)C=C1)C1=C(C)C=C(F)C=C1 |
|---|
KEYWORDS: buy LDC1267 | LDC1267 supplier | purchase | cost | manufacturer | order | distributor | buy 1361030-48-9 | 1361030-48-9 supplier