Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A898 | Purity: >98% |
 | |
| Chemical structure of LDC000067 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1073485-20-7 |
|---|---|
| Purity | >98% |
| Formula | C18H18N4O3S |
| Mol Weight | 370.426 |
| CoA | CoA of LDC000067 |
| Smiles: | COC1=CC=CC=C1C1=CC(NC2=CC(CS(N)(=O)=O)=CC=C2)=NC=N1 |
|---|
KEYWORDS: buy LDC000067 | LDC000067 supplier | purchase | cost | manufacturer | order | distributor | buy 1073485-20-7 | 1073485-20-7 supplier