Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10387A | Purity: >98% |
 | |
| Chemical structure of L-NIL hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 50403-89-7 |
|---|---|
| Purity | >98% |
| Formula | C8H18ClN3O2 |
| Mol Weight | 223.7 |
| CoA | CoA of L-NIL hydrochloride |
| Smiles: | Cl[H].CC(=N)NCCCC[C@H](N)C(O)=O |
|---|
KEYWORDS: buy L-NIL hydrochloride | L-NIL hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 50403-89-7 | 50403-89-7 supplier