Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11712 | Purity: >97% |
 | |
| Chemical structure of L-Cystinol HCl |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2494357-27-4 |
|---|---|
| Purity | >97% |
| Formula | C6H17ClN2O2S2 |
| Mol Weight | 248.794 |
| CoA | CoA of L-Cystinol HCl |
| Smiles: | C(SSC[C@@H](CO)N)[C@@H](CO)N.Cl |
|---|
KEYWORDS: buy L-Cystinol HCl | L-Cystinol HCl supplier | purchase | cost | manufacturer | order | distributor | buy 2494357-27-4 | 2494357-27-4 supplier