Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A587 | Purity: >98% |
 | |
| Chemical structure of L-701324 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | L-701,324 |
|---|---|
| CAS No. | 142326-59-8 |
| Purity | >98% |
| Formula | C21H14ClNO3 |
| Mol Weight | 363.794 |
| CoA | CoA of L-701324 |
| Smiles: | OC1=C(C(=O)NC2=C1C=CC(Cl)=C2)C1=CC=CC(OC2=CC=CC=C2)=C1 |
|---|
KEYWORDS: buy L-701324 | L-701324 supplier | purchase | cost | manufacturer | order | distributor | buy 142326-59-8 | 142326-59-8 supplier