Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2088 | Purity: >98% |
 | |
| Chemical structure of KX1-004 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 518058-84-9 |
|---|---|
| Purity | >98% |
| Formula | C16H13FN2O2 |
| Mol Weight | 284.285 |
| CoA | CoA of KX1-004 |
| Smiles: | OC1=CC(CNC(=O)C2=CC3=C(N2)C=CC(F)=C3)=CC=C1 |
|---|
KEYWORDS: buy KX1-004 | KX1-004 supplier | purchase | cost | manufacturer | order | distributor | buy 518058-84-9 | 518058-84-9 supplier