Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A125 | Purity: >98% |
 | |
| Chemical structure of KU14R |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 189224-48-4 |
|---|---|
| Purity | >98% |
| Formula | C13H14N2O |
| Mol Weight | 214.2631 |
| CoA | CoA of KU14R |
| Smiles: | CCC1(CC2=CC=CC=C2O1)C1=NC=CN1 |
|---|
KEYWORDS: buy KU14R | KU14R supplier | purchase | cost | manufacturer | order | distributor | buy 189224-48-4 | 189224-48-4 supplier