Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2236 | Purity: >98% |
 | |
| Chemical structure of KRCA-0008 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1472795-20-2 |
|---|---|
| Purity | >98% |
| Formula | C30H37ClN8O4 |
| Mol Weight | 609.119 |
| CoA | CoA of KRCA-0008 |
| Smiles: | COC1=CC(=CC=C1NC1=NC=C(Cl)C(NC2=CC=C(C=C2OC)N2CCN(CC2)C(C)=O)=N1)N1CCN(CC1)C(C)=O |
|---|
KEYWORDS: buy KRCA-0008 | KRCA-0008 supplier | purchase | cost | manufacturer | order | distributor | buy 1472795-20-2 | 1472795-20-2 supplier