Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A871 | Purity: >98% |
 | |
| Chemical structure of KPT335 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Verdinexor |
|---|---|
| CAS No. | 1392136-43-4 |
| Purity | >98% |
| Formula | C18H12F6N6O |
| Mol Weight | 442.3179 |
| CoA | CoA of KPT335 |
| Smiles: | FC(F)(F)C1=CC(=CC(=C1)C1=NN(C=N1)\C=C/C(=O)NNC1=NC=CC=C1)C(F)(F)F |
|---|
KEYWORDS: buy KPT335 | KPT335 supplier | purchase | cost | manufacturer | order | distributor | buy 1392136-43-4 | 1392136-43-4 supplier