Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A369 | Purity: >98% |
 | |
| Chemical structure of Kobe2602 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 454453-49-7 |
|---|---|
| Purity | >98% |
| Formula | C14H9F4N5O4S |
| Mol Weight | 419.311 |
| CoA | CoA of Kobe2602 |
| Smiles: | [O-][N+](=O)C1=CC(=CC(=C1NNC(=S)NC1=CC=C(F)C=C1)[N+]([O-])=O)C(F)(F)F |
|---|
KEYWORDS: buy Kobe2602 | Kobe2602 supplier | purchase | cost | manufacturer | order | distributor | buy 454453-49-7 | 454453-49-7 supplier