Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A370 | Purity: >98% |
 | |
| Chemical structure of Kobe0065 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 436133-68-5 |
|---|---|
| Purity | >98% |
| Formula | C15H11ClF3N5O4S |
| Mol Weight | 449.792 |
| CoA | CoA of Kobe0065 |
| Smiles: | CC1=CC=C(NC(=S)NNC2=C(C=C(C=C2[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O)C=C1Cl |
|---|
KEYWORDS: buy Kobe0065 | Kobe0065 supplier | purchase | cost | manufacturer | order | distributor | buy 436133-68-5 | 436133-68-5 supplier