Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2086 | Purity: >98% |
 | |
| Chemical structure of KN-93 Phosphate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1188890-41-6 |
|---|---|
| Purity | >98% |
| Formula | C26H32ClN2O8PS |
| Mol Weight | 599.033 |
| CoA | CoA of KN-93 Phosphate |
| Smiles: | OP(O)(O)=O.COC1=CC=C(C=C1)S(=O)(=O)N(CCO)C1=CC=CC=C1CN(C)C\C=C\C1=CC=C(Cl)C=C1 |
|---|
KEYWORDS: buy KN-93 Phosphate | KN-93 Phosphate supplier | purchase | cost | manufacturer | order | distributor | buy 1188890-41-6 | 1188890-41-6 supplier