Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2249 | Purity: >98% |
 | |
| Chemical structure of Ki16425 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 355025-24-0 |
|---|---|
| Purity | >98% |
| Formula | C23H23ClN2O5S |
| Mol Weight | 474.957 |
| CoA | CoA of Ki16425 |
| Smiles: | CC(OC(=O)NC1=C(ON=C1C)C1=CC=C(CSCCC(O)=O)C=C1)C1=C(Cl)C=CC=C1 |
|---|
KEYWORDS: buy Ki16425 | Ki16425 supplier | purchase | cost | manufacturer | order | distributor | buy 355025-24-0 | 355025-24-0 supplier