Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2746 | Purity: 98.87% |
 | |
| Chemical structure of KHS101 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1262770-73-9 |
|---|---|
| Purity | 98.87% |
| Formula | C18H21N5S |
| Mol Weight | 339.458 |
| CoA | CoA of KHS101 |
| Smiles: | CC(C)CNC1=NC(NCC2=CSC(=N2)C2=CC=CC=C2)=NC=C1 |
|---|
KEYWORDS: buy KHS101 | KHS101 supplier | purchase | cost | manufacturer | order | distributor | buy 1262770-73-9 | 1262770-73-9 supplier