Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17111 | Purity: >98% |
 | |
| Chemical structure of KHKI-01128 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3132056-83-5 |
|---|---|
| Purity | >98% |
| Formula | C29H34F3N9O |
| Mol Weight | 581.6352 |
| CoA | CoA of KHKI-01128 |
| Smiles: | N#CC1=CN=C(N=C1NC2=CC=C(C=C2OC)N3CCN(C)CC3)NC4=CC=C(C(=C4)C(F)(F)F)N5CCN(C)CC5 |
|---|
KEYWORDS: buy KHKI-01128 | KHKI-01128 supplier | purchase | cost | manufacturer | order | distributor | buy 3132056-83-5 | 3132056-83-5 supplier