Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3681 | Purity: >98% |
 | |
| Chemical structure of KAN0438757 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1451255-59-6 |
|---|---|
| Purity | >98% |
| Formula | C21H18FNO7S |
| Mol Weight | 447.434 |
| CoA | CoA of KAN0438757 |
| Smiles: | O=C(OCCO)C1=CC=C(NS(=O)(C2=CC(C3=CC(F)=CC=C3O)=CC=C2)=O)C=C1O |
|---|
KEYWORDS: buy KAN0438757 | KAN0438757 supplier | purchase | cost | manufacturer | order | distributor | buy 1451255-59-6 | 1451255-59-6 supplier