Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A479-1 | Purity: >98% |
 | |
| Chemical structure of K145 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | SphK2 inhibitor |
|---|---|
| CAS No. | 1309444-75-4 |
| Purity | >98% |
| Formula | C18H24N2O3S |
| Mol Weight | 348.46 |
| CoA | CoA of K145 |
| Smiles: | CCCCOC1=CC=C(CC\C=C2/SC(=O)N(CCN)C2=O)C=C1 |
|---|
KEYWORDS: buy K145 | K145 supplier | purchase | cost | manufacturer | order | distributor | buy 1309444-75-4 | 1309444-75-4 supplier