Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1910 | Purity: >98% |
 | |
| Chemical structure of K03861 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 853299-07-7 |
|---|---|
| Purity | >98% |
| Formula | C24H26F3N7O2 |
| Mol Weight | 501.5041 |
| CoA | CoA of K03861 |
| Smiles: | CN1CCN(CC2=C(C=C(NC(=O)NC3=CC=C(OC4=NC(N)=NC=C4)C=C3)C=C2)C(F)(F)F)CC1 |
|---|
KEYWORDS: buy K03861 | K03861 supplier | purchase | cost | manufacturer | order | distributor | buy 853299-07-7 | 853299-07-7 supplier