Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A274 | Purity: >98% |
 | |
| Chemical structure of JW-55 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 664993-53-7 |
|---|---|
| Purity | >98% |
| Formula | C25H26N2O5 |
| Mol Weight | 434.4843 |
| CoA | CoA of JW-55 |
| Smiles: | COC1=CC=C(C=C1)C1(CNC(=O)C2=CC=C(NC(=O)C3=CC=CO3)C=C2)CCOCC1 |
|---|
KEYWORDS: buy JW-55 | JW-55 supplier | purchase | cost | manufacturer | order | distributor | buy 664993-53-7 | 664993-53-7 supplier