Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2083 | Purity: >98% |
 | |
| Chemical structure of JSH-23 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 749886-87-1 |
|---|---|
| Purity | >98% |
| Formula | C16H20N2 |
| Mol Weight | 240.3434 |
| CoA | CoA of JSH-23 |
| Smiles: | CC1=CC=C(NCCCC2=CC=CC=C2)C(N)=C1 |
|---|
KEYWORDS: buy JSH-23 | JSH-23 supplier | purchase | cost | manufacturer | order | distributor | buy 749886-87-1 | 749886-87-1 supplier