Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2082 | Purity: >98% |
 | |
| Chemical structure of JNJ-7777120 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 459168-41-3 |
|---|---|
| Purity | >98% |
| Formula | C14H16ClN3O |
| Mol Weight | 277.749 |
| CoA | CoA of JNJ-7777120 |
| Smiles: | CN1CCN(CC1)C(=O)C1=CC2=C(N1)C=CC(Cl)=C2 |
|---|
KEYWORDS: buy JNJ-7777120 | JNJ-7777120 supplier | purchase | cost | manufacturer | order | distributor | buy 459168-41-3 | 459168-41-3 supplier