Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A740 | Purity: >98% |
 | |
| Chemical structure of JNJ-42041935 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1193383-09-3 |
|---|---|
| Purity | >98% |
| Formula | C12H6ClF3N4O3 |
| Mol Weight | 346.649 |
| CoA | CoA of JNJ-42041935 |
| Smiles: | OC(=O)C1=CN(N=C1)C1=NC2=CC(OC(F)(F)F)=C(Cl)C=C2N1 |
|---|
KEYWORDS: buy JNJ-42041935 | JNJ-42041935 supplier | purchase | cost | manufacturer | order | distributor | buy 1193383-09-3 | 1193383-09-3 supplier