Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A267 | Purity: >98% |
 | |
| Chemical structure of JNJ-26854165 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Serdemetan |
|---|---|
| CAS No. | 881202-45-5 |
| Purity | >98% |
| Formula | C21H20N4 |
| Mol Weight | 328.4103 |
| CoA | CoA of JNJ-26854165 |
| Smiles: | C(CC1=CNC2=C1C=CC=C2)NC1=CC=C(NC2=CC=NC=C2)C=C1 |
|---|
KEYWORDS: buy JNJ-26854165 | JNJ-26854165 supplier | purchase | cost | manufacturer | order | distributor | buy 881202-45-5 | 881202-45-5 supplier