Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3709 | Purity: >98% |
 | |
| Chemical structure of JNJ-10229570 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 524923-88-4 |
|---|---|
| Purity | >98% |
| Formula | C22H19N3O2S |
| Mol Weight | 389.47 |
| CoA | CoA of JNJ-10229570 |
| Smiles: | COC1=C(C=CC=C1)C(N(C2=C(C=CC=C2)OC)S/3)=NC3=N\C4=CC=CC=C4 |
|---|
KEYWORDS: buy JNJ-10229570 | JNJ-10229570 supplier | purchase | cost | manufacturer | order | distributor | buy 524923-88-4 | 524923-88-4 supplier