Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2455 | Purity: >98% |
 | |
| Chemical structure of IWP-4 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 686772-17-8 |
|---|---|
| Purity | >98% |
| Formula | C23H20N4O3S3 |
| Mol Weight | 496.625 |
| CoA | CoA of IWP-4 |
| Smiles: | COC1=CC=CC=C1N1C(=O)C2=C(CCS2)N=C1SCC(=O)NC1=NC2=CC=C(C)C=C2S1 |
|---|
KEYWORDS: buy IWP-4 | IWP-4 supplier | purchase | cost | manufacturer | order | distributor | buy 686772-17-8 | 686772-17-8 supplier