Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16568 | Purity: >98% |
 | |
| Chemical structure of ITK degrader 1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ITK degrader 1 |
|---|---|
| CAS No. | 3034476-38-2 |
| Purity | >98% |
| Formula | C46H56N10O5 |
| Mol Weight | 829.0008 |
| CoA | CoA of ITK degrader 1 |
| Smiles: | O=C1C=2C(C(=O)N1C3C(=O)NC(=O)CC3)=CC=C(C2)N4CCC(CCN5CCN(CC[C@H](N6C=C(NC(=O)C=7C8=C(NN7)CC(C)(C)CC8)C=N6)C9=CC=CC=C9)CC5)CC4 |
|---|
KEYWORDS: buy ITK degrader 1 | ITK degrader 1 supplier | purchase | cost | manufacturer | order | distributor | buy 3034476-38-2 | 3034476-38-2 supplier