Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1251 | Purity: >98% |
 | |
| Chemical structure of ITE |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 448906-42-1 |
|---|---|
| Purity | >98% |
| Formula | C14H10N2O3S |
| Mol Weight | 286.306 |
| CoA | CoA of ITE |
| Smiles: | COC(=O)C1=CSC(=N1)C(=O)C1=CNC2=C1C=CC=C2 |
|---|
KEYWORDS: buy ITE | ITE supplier | purchase | cost | manufacturer | order | distributor | buy 448906-42-1 | 448906-42-1 supplier