Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11597 | Purity: >98% |
 | |
| Chemical structure of Isoxafenacil |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Isoxafenacil |
|---|---|
| CAS No. | 1949837-17-5 |
| Purity | >98% |
| Formula | C19H16ClF4N3O5 |
| Mol Weight | 477.794 |
| CoA | CoA of Isoxafenacil |
| Smiles: | O=C1C=C(N(C(=O)N1C2=CC(=C(Cl)C=C2F)C3=NOC(C(=O)OCC)(C)C3)C)C(F)(F)F |
|---|
KEYWORDS: buy Isoxafenacil | Isoxafenacil supplier | purchase | cost | manufacturer | order | distributor | buy 1949837-17-5 | 1949837-17-5 supplier