Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9623K | Purity: >98% |
 | |
| Chemical structure of Isofuranodienone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | (5Z,9E)-8,11-Dihydro-3,6,10-trimethylcyclodeca[b]furan-4(7H)-one |
|---|---|
| CAS No. | 24268-42-6 |
| Purity | >98% |
| Formula | C15H18O2 |
| Mol Weight | 230.3022 |
| CoA | CoA of Isofuranodienone |
| Smiles: | CC1=COC2=C1C(=O)\C=C(C)/CC\C=C(C)\C2 |
|---|
KEYWORDS: buy Isofuranodienone | Isofuranodienone supplier | purchase | cost | manufacturer | order | distributor | buy 24268-42-6 | 24268-42-6 supplier