Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12099 | Purity: >98% |
 | |
| Chemical structure of IRDye 680RD |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | IRDye 680RD NHS Ester |
|---|---|
| CAS No. | 1373919-87-9 |
| Purity | >98% |
| Formula | C43H48ClN4NaO13S3 |
| Mol Weight | 983.498 |
| CoA | CoA of IRDye 680RD |
| Smiles: | [Na].O=C(ON1C(=O)CCC1=O)CCC=2C=CC=C(C2)C(C=CC3=NC=4C(=CC(Cl)=C[N+]4CCCS(=O)(=O)[O-])C3(C)C)=CC=C5N(C6=CC=C(C=C6C5(C)C)S(=O)(=O)O)CCCS(=O)(=O)O |
|---|
KEYWORDS: buy IRDye 680RD | IRDye 680RD supplier | purchase | cost | manufacturer | order | distributor | buy 1373919-87-9 | 1373919-87-9 supplier