Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2567 | Purity: >98% |
 | |
| Chemical structure of IRAK inhibitor 6 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1042672-97-8 |
|---|---|
| Purity | >98% |
| Formula | C20H20N4O3S |
| Mol Weight | 396.463 |
| CoA | CoA of IRAK inhibitor 6 |
| Smiles: | COC1=CC(=CC=C1NC(=O)C1=CSC(=N1)C1=CC=CN=C1)N1CCOCC1 |
|---|
KEYWORDS: buy IRAK inhibitor 6 | IRAK inhibitor 6 supplier | purchase | cost | manufacturer | order | distributor | buy 1042672-97-8 | 1042672-97-8 supplier