Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16429S | Purity: >97% |
 | |
| Chemical structure of iPrPhTXPhos |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | 2,6-bis(2,4,6-triisopropylphenyl)phenyl-isopropylcylphenylphosphine |
|---|---|
| CAS No. | 2376379-80-3 |
| Purity | >97% |
| Formula | C45H61P |
| Mol Weight | 632.9396 |
| CoA | CoA of iPrPhTXPhos |
| Smiles: | C=1C=CC(=CC1)P(C2=C(C=CC=C2C=3C(=CC(=CC3C(C)C)C(C)C)C(C)C)C4=C(C=C(C=C4C(C)C)C(C)C)C(C)C)C(C)C |
|---|
KEYWORDS: buy iPrPhTXPhos | iPrPhTXPhos supplier | purchase | cost | manufacturer | order | distributor | buy 2376379-80-3 | 2376379-80-3 supplier