Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15012 | Purity: >98% |
 | |
| Chemical structure of IP7 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 193743-89-4 |
|---|---|
| Purity | >98% |
| Formula | C6H20NaO27P7 |
| Mol Weight | 764.0129 |
| CoA | CoA of IP7 |
| Smiles: | O(P(OP(=O)(O)O)(=O)O)[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O.[Na] |
|---|
KEYWORDS: buy IP7 | IP7 supplier | purchase | cost | manufacturer | order | distributor | buy 193743-89-4 | 193743-89-4 supplier