Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2010 | Purity: 0.9887 |
 | |
| Chemical structure of INF-39 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 866028-26-4 |
|---|---|
| Purity | 0.9887 |
| Formula | C12H13ClO2 |
| Mol Weight | 224.683 |
| CoA | CoA of INF-39 |
| Smiles: | CCOC(=O)C(=C)CC1=CC=CC=C1Cl |
|---|
KEYWORDS: buy INF-39 | INF-39 supplier | purchase | cost | manufacturer | order | distributor | buy 866028-26-4 | 866028-26-4 supplier