Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A347 | Purity: >98% |
 | |
| Chemical structure of Indirubin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 479-41-4 |
|---|---|
| Purity | >98% |
| Formula | C16H10N2O2 |
| Mol Weight | 262.2628 |
| CoA | CoA of Indirubin |
| Smiles: | O=C1NC2=C(C=CC=C2)\C1=C1/NC2=C(C=CC=C2)C1=O |
|---|
KEYWORDS: buy Indirubin | Indirubin supplier | purchase | cost | manufacturer | order | distributor | buy 479-41-4 | 479-41-4 supplier