Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14202 | Purity: >98% |
 | |
| Chemical structure of Indiplon |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 325715-02-4 |
|---|---|
| Purity | >98% |
| Formula | C20H16N4O2S |
| Mol Weight | 376.432 |
| CoA | CoA of Indiplon |
| Smiles: | CC(=O)N(C)C1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C(=O)C4=CC=CS4 |
|---|
KEYWORDS: buy Indiplon | Indiplon supplier | purchase | cost | manufacturer | order | distributor | buy 325715-02-4 | 325715-02-4 supplier