Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2970 | Purity: >98% |
 | |
| Chemical structure of IN00076730 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1454700-89-0 |
|---|---|
| Purity | >98% |
| Formula | C17H21BrO2 |
| Mol Weight | 337.251 |
| CoA | CoA of IN00076730 |
| Smiles: | COC1[C@@H](C)CC2(CC3=C(C=C(Br)C=C3)C2=O)C[C@H]1C |
|---|
KEYWORDS: buy IN00076730 | IN00076730 supplier | purchase | cost | manufacturer | order | distributor | buy 1454700-89-0 | 1454700-89-0 supplier