Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1203 | Purity: >98% |
 | |
| Chemical structure of Importazole |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 662163-81-7 |
|---|---|
| Purity | >98% |
| Formula | C20H22N4 |
| Mol Weight | 318.4155 |
| CoA | CoA of Importazole |
| Smiles: | CC(NC1=C2C=CC=CC2=NC(=N1)N1CCCC1)C1=CC=CC=C1 |
|---|
KEYWORDS: buy Importazole | Importazole supplier | purchase | cost | manufacturer | order | distributor | buy 662163-81-7 | 662163-81-7 supplier