Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2449 | Purity: >98% |
 | |
| Chemical structure of IMM-02 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 218929-99-8 |
|---|---|
| Purity | >98% |
| Formula | C13H17F2N3OS |
| Mol Weight | 301.355 |
| CoA | CoA of IMM-02 |
| Smiles: | C\C(C1=CC(F)=CC(F)=C1O)=N/NC(=S)NC(C)(C)C |
|---|
KEYWORDS: buy IMM-02 | IMM-02 supplier | purchase | cost | manufacturer | order | distributor | buy 218929-99-8 | 218929-99-8 supplier