Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9709 | Purity: >98% |
 | |
| Chemical structure of Imidol hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 865171-50-2 |
|---|---|
| Purity | >98% |
| Formula | C23H22BrN3O4S |
| Mol Weight | 516.407 |
| CoA | CoA of Imidol hydrochloride |
| Smiles: | O=C(OCC)C=1C=2C(=CC(Br)=C(O)C2CN3C=NC=C3)N(C1CS(=O)C=4C=CC=CC4)C |
|---|
KEYWORDS: buy Imidol hydrochloride | Imidol hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 865171-50-2 | 865171-50-2 supplier