Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A5012 | Purity: >98% |
 | |
| Chemical structure of IDO-IN-2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2119738-71-3 |
|---|---|
| Purity | >98% |
| Formula | C25H29ClFN7O2 |
| Mol Weight | 513.995 |
| CoA | CoA of IDO-IN-2 |
| Smiles: | CNC1CCN(C1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4C(=O)NC)Cl)OCCF |
|---|
KEYWORDS: buy IDO-IN-2 | IDO-IN-2 supplier | purchase | cost | manufacturer | order | distributor | buy 2119738-71-3 | 2119738-71-3 supplier