Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A306 | Purity: >98% |
 | |
| Chemical structure of Icotinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 610798-31-7 |
|---|---|
| Purity | >98% |
| Formula | C22H21N3O4 |
| Mol Weight | 391.4198 |
| CoA | CoA of Icotinib |
| Smiles: | C#CC1=CC(NC2=C3C=C4OCCOCCOCCOC4=CC3=NC=N2)=CC=C1 |
|---|
KEYWORDS: buy Icotinib | Icotinib supplier | purchase | cost | manufacturer | order | distributor | buy 610798-31-7 | 610798-31-7 supplier